C13H7F9N2O — CID 14253808
N-[4-(cyanomethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide (PubChem CID 14253808) has the molecular formula C13H7F9N2O and a molecular weight of 378.19 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
|---|---|
| PubChem CID | 14253808 |
| Molecular Formula | C13H7F9N2O |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2,2,3,3,4,4,5,5,5-nonafluoropentanamide |
| SMILES | N#CCc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H7F9N2O/c14-10(15,11(16,17)12(18,19)13(20,21)22)9(25)24-8-3-1-7(2-4-8)5-6-23/h1-4H,5H2,(H,24,25) |
| InChIKey | VYOPTNWQTVZZOL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|