C16H8F15N5O — CID 14253811
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]octanamide (PubChem CID 14253811) has the molecular formula C16H8F15N5O and a molecular weight of 571.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]octanamide |
|---|---|
| PubChem CID | 14253811 |
| Molecular Formula | C16H8F15N5O |
| Molecular Weight | 571.24 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-ylmethyl)phenyl]octanamide |
| SMILES | O=C(Nc1ccc(Cc2nn[nH]n2)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H8F15N5O/c17-10(18,9(37)32-7-3-1-6(2-4-7)5-8-33-35-36-34-8)11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)31/h1-4H,5H2,(H,32,37)(H,33,34,35,36) |
| InChIKey | BVRHHXOKIFLASO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|