C9H2F15N5O — CID 15164340
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(2H-tetrazol-5-yl)octanamide (PubChem CID 15164340) has the molecular formula C9H2F15N5O and a molecular weight of 481.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(2H-tetrazol-5-yl)octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(2H-tetrazol-5-yl)octanamide |
|---|---|
| PubChem CID | 15164340 |
| Molecular Formula | C9H2F15N5O |
| Molecular Weight | 481.12 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(2H-tetrazol-5-yl)octanamide |
| SMILES | O=C(Nc1nn[nH]n1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H2F15N5O/c10-3(11,1(30)25-2-26-28-29-27-2)4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)24/h(H2,25,26,27,28,29,30) |
| InChIKey | VRGPKDLPIUMGTL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|