C13H8F15N5O — CID 173369483
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-yl)but-2-enyl]octanamide (PubChem CID 173369483) has the molecular formula C13H8F15N5O and a molecular weight of 535.21 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-yl)but-2-enyl]octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-yl)but-2-enyl]octanamide |
|---|---|
| PubChem CID | 173369483 |
| Molecular Formula | C13H8F15N5O |
| Molecular Weight | 535.21 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-[4-(2H-tetrazol-5-yl)but-2-enyl]octanamide |
| SMILES | O=C(NCC=CCc1nn[nH]n1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F15N5O/c14-7(15,6(34)29-4-2-1-3-5-30-32-33-31-5)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h1-2H,3-4H2,(H,29,34)(H,30,31,32,33) |
| InChIKey | YZIQPXGBSBKGSR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|