C4H5Cl2N5O — CID 130734610
2,2-dichloro-N-(2H-tetrazol-5-yl)propanamide (PubChem CID 130734610) has the molecular formula C4H5Cl2N5O and a molecular weight of 210.02 g/mol. Its IUPAC name is 2,2-dichloro-N-(2H-tetrazol-5-yl)propanamide.
| Compound Name | 2,2-dichloro-N-(2H-tetrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 130734610 |
| Molecular Formula | C4H5Cl2N5O |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 2,2-dichloro-N-(2H-tetrazol-5-yl)propanamide |
| SMILES | CC(Cl)(Cl)C(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C4H5Cl2N5O/c1-4(5,6)2(12)7-3-8-10-11-9-3/h1H3,(H2,7,8,9,10,11,12) |
| InChIKey | PWBYYIHKYMCMGO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|