C6H11N5O — CID 4550448
3-methyl-N-(2H-tetrazol-5-yl)butanamide (PubChem CID 4550448) has the molecular formula C6H11N5O and a molecular weight of 169.19 g/mol. Its IUPAC name is 3-methyl-N-(2H-tetrazol-5-yl)butanamide.
| Compound Name | 3-methyl-N-(2H-tetrazol-5-yl)butanamide |
|---|---|
| PubChem CID | 4550448 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 3-methyl-N-(2H-tetrazol-5-yl)butanamide |
| SMILES | CC(C)CC(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C6H11N5O/c1-4(2)3-5(12)7-6-8-10-11-9-6/h4H,3H2,1-2H3,(H2,7,8,9,10,11,12) |
| InChIKey | HRGRYMGYDJCASV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |