C4H6ClN5O — CID 3253359
3-chloro-N-(2H-tetrazol-5-yl)propanamide (PubChem CID 3253359) has the molecular formula C4H6ClN5O and a molecular weight of 175.58 g/mol. Its IUPAC name is 3-chloro-N-(2H-tetrazol-5-yl)propanamide.
| Compound Name | 3-chloro-N-(2H-tetrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 3253359 |
| Molecular Formula | C4H6ClN5O |
| Molecular Weight | 175.58 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 3-chloro-N-(2H-tetrazol-5-yl)propanamide |
| SMILES | O=C(CCCl)Nc1nn[nH]n1 |
| InChI | InChI=1S/C4H6ClN5O/c5-2-1-3(11)6-4-7-9-10-8-4/h1-2H2,(H2,6,7,8,9,10,11) |
| InChIKey | ZBORQFMARBBGOX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.58 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|