C8H8ClN5OS — CID 56824715
3-(5-chlorothiophen-2-yl)-N-(2H-tetrazol-5-yl)propanamide (PubChem CID 56824715) has the molecular formula C8H8ClN5OS and a molecular weight of 257.71 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-(2H-tetrazol-5-yl)propanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-(2H-tetrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 56824715 |
| Molecular Formula | C8H8ClN5OS |
| Molecular Weight | 257.71 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-(2H-tetrazol-5-yl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)s1)Nc1nn[nH]n1 |
| InChI | InChI=1S/C8H8ClN5OS/c9-6-3-1-5(16-6)2-4-7(15)10-8-11-13-14-12-8/h1,3H,2,4H2,(H2,10,11,12,13,14,15) |
| InChIKey | QEBMJGGLSMRFTL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |