C16H19Cl2N3O2S — CID 120603678
N-(2-aminoethyl)-2-[3-(5-chlorothiophen-2-yl)propanoylamino]benzamide;hydrochloride (PubChem CID 120603678) has the molecular formula C16H19Cl2N3O2S and a molecular weight of 388.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[3-(5-chlorothiophen-2-yl)propanoylamino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[3-(5-chlorothiophen-2-yl)propanoylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120603678 |
| Molecular Formula | C16H19Cl2N3O2S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | N-(2-aminoethyl)-2-[3-(5-chlorothiophen-2-yl)propanoylamino]benzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ccccc1NC(=O)CCc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H18ClN3O2S.ClH/c17-14-7-5-11(23-14)6-8-15(21)20-13-4-2-1-3-12(13)16(22)19-10-9-18;/h1-5,7H,6,8-10,18H2,(H,19,22)(H,20,21);1H |
| InChIKey | IAHAMSOTZGZURC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |