C16H20ClN3O2S — CID 120604324
N-(2-aminoethyl)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]benzamide;hydrochloride (PubChem CID 120604324) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120604324 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | N-(2-aminoethyl)-2-[[2-(5-methylthiophen-2-yl)acetyl]amino]benzamide;hydrochloride |
| SMILES | Cc1ccc(CC(=O)Nc2ccccc2C(=O)NCCN)s1.Cl |
| InChI | InChI=1S/C16H19N3O2S.ClH/c1-11-6-7-12(22-11)10-15(20)19-14-5-3-2-4-13(14)16(21)18-9-8-17;/h2-7H,8-10,17H2,1H3,(H,18,21)(H,19,20);1H |
| InChIKey | AAMSOPHJPNKSSE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |