C15H12ClN3OS — CID 51319532
2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 51319532) has the molecular formula C15H12ClN3OS and a molecular weight of 317.80 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51319532 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | N#CCc1ccc(NC(=O)CSc2ncccc2Cl)cc1 |
| InChI | InChI=1S/C15H12ClN3OS/c16-13-2-1-9-18-15(13)21-10-14(20)19-12-5-3-11(4-6-12)7-8-17/h1-6,9H,7,10H2,(H,19,20) |
| InChIKey | XMDWUFYZNLAECF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |