C12H11ClN4OS — CID 106679046
2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide (PubChem CID 106679046) has the molecular formula C12H11ClN4OS and a molecular weight of 294.77 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 106679046 |
| Molecular Formula | C12H11ClN4OS |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-chlorophenyl)acetamide |
| SMILES | Nc1nccnc1SCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H11ClN4OS/c13-8-1-3-9(4-2-8)17-10(18)7-19-12-11(14)15-5-6-16-12/h1-6H,7H2,(H2,14,15)(H,17,18) |
| InChIKey | HVWNOOPHYIGLMU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |