C12H10Cl2N4OS — CID 106678563
2-(3-aminopyrazin-2-yl)sulfanyl-N-(2,3-dichlorophenyl)acetamide (PubChem CID 106678563) has the molecular formula C12H10Cl2N4OS and a molecular weight of 329.21 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 106678563 |
| Molecular Formula | C12H10Cl2N4OS |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(2,3-dichlorophenyl)acetamide |
| SMILES | Nc1nccnc1SCC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl2N4OS/c13-7-2-1-3-8(10(7)14)18-9(19)6-20-12-11(15)16-4-5-17-12/h1-5H,6H2,(H2,15,16)(H,18,19) |
| InChIKey | JTNNSOJWQUINTJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |