C13H13BrN4OS — CID 106679065
2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-bromo-2-methylphenyl)acetamide (PubChem CID 106679065) has the molecular formula C13H13BrN4OS and a molecular weight of 353.25 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-bromo-2-methylphenyl)acetamide.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-bromo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 106679065 |
| Molecular Formula | C13H13BrN4OS |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(4-bromo-2-methylphenyl)acetamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CSc1nccnc1N |
| InChI | InChI=1S/C13H13BrN4OS/c1-8-6-9(14)2-3-10(8)18-11(19)7-20-13-12(15)16-4-5-17-13/h2-6H,7H2,1H3,(H2,15,16)(H,18,19) |
| InChIKey | XAZOARFEOWNLFV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |