C14H16N4O2S — CID 106678992
2-(3-aminopyrazin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide (PubChem CID 106678992) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-(3-aminopyrazin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 106678992 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-(3-aminopyrazin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nccnc1N |
| InChI | InChI=1S/C14H16N4O2S/c1-2-20-11-6-4-3-5-10(11)18-12(19)9-21-14-13(15)16-7-8-17-14/h3-8H,2,9H2,1H3,(H2,15,16)(H,18,19) |
| InChIKey | DRMUHFQVCNKZBU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |