C15H15N5O2S — CID 40662535
2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide (PubChem CID 40662535) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 40662535 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C15H15N5O2S/c1-2-22-12-6-4-3-5-11(12)19-13(21)9-23-15-18-8-10(7-16)14(17)20-15/h3-6,8H,2,9H2,1H3,(H,19,21)(H2,17,18,20) |
| InChIKey | CKKCTIBYAVMAPA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |