C13H11N5O2S — CID 6492735
2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-hydroxyphenyl)acetamide (PubChem CID 6492735) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 6492735 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(2-hydroxyphenyl)acetamide |
| SMILES | N#Cc1cnc(SCC(=O)Nc2ccccc2O)nc1N |
| InChI | InChI=1S/C13H11N5O2S/c14-5-8-6-16-13(18-12(8)15)21-7-11(20)17-9-3-1-2-4-10(9)19/h1-4,6,19H,7H2,(H,17,20)(H2,15,16,18) |
| InChIKey | ZWMUZTFMLAVPLD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|