C16H16N6OS2 — CID 46232619
2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 46232619) has the molecular formula C16H16N6OS2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 46232619 |
| Molecular Formula | C16H16N6OS2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-(4-amino-5-cyanopyrimidin-2-yl)sulfanyl-N-(3-cyano-3a,4,5,6,7,7a-hexahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | N#CC1=C(NC(=O)CSc2ncc(C#N)c(N)n2)SC2CCCCC12 |
| InChI | InChI=1S/C16H16N6OS2/c17-5-9-7-20-16(22-14(9)19)24-8-13(23)21-15-11(6-18)10-3-1-2-4-12(10)25-15/h7,10,12H,1-4,8H2,(H,21,23)(H2,19,20,22) |
| InChIKey | UCRYJTLNUSLUAU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |