C17H18N6O2S — CID 8809293
2-[[2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2-ethylphenyl)acetamide (PubChem CID 8809293) has the molecular formula C17H18N6O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 2-[[2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-[[2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 8809293 |
| Molecular Formula | C17H18N6O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[[2-(4-amino-5-cyanopyrimidin-2-yl)sulfanylacetyl]amino]-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CNC(=O)CSc1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C17H18N6O2S/c1-2-11-5-3-4-6-13(11)22-14(24)9-20-15(25)10-26-17-21-8-12(7-18)16(19)23-17/h3-6,8H,2,9-10H2,1H3,(H,20,25)(H,22,24)(H2,19,21,23) |
| InChIKey | CSFQDTARWFQURF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |