C25H29N5O3S — CID 46393657
N-(2-ethoxyphenyl)-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide (PubChem CID 46393657) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-ethoxyphenyl)-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46393657 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nccnc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C25H29N5O3S/c1-3-33-21-10-6-4-8-19(21)28-23(31)18-34-25-24(26-12-13-27-25)30-16-14-29(15-17-30)20-9-5-7-11-22(20)32-2/h4-13H,3,14-18H2,1-2H3,(H,28,31) |
| InChIKey | ZXGXAHJVTULOMD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |