C26H31N5O2S — CID 95919409
N-benzyl-N-ethyl-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide (PubChem CID 95919409) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-N-ethyl-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 95919409 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-benzyl-N-ethyl-2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanylacetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CSc1nccnc1N1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C26H31N5O2S/c1-3-29(19-21-9-5-4-6-10-21)24(32)20-34-26-25(27-13-14-28-26)31-17-15-30(16-18-31)22-11-7-8-12-23(22)33-2/h4-14H,3,15-20H2,1-2H3 |
| InChIKey | FUMXLGDUOOAITL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |