C25H29N5O2S — CID 46393694
2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide (PubChem CID 46393694) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 46393694 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]pyrazin-2-yl]sulfanyl-N-(2-phenylethyl)acetamide |
| SMILES | COc1ccccc1N1CCN(c2nccnc2SCC(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N5O2S/c1-32-22-10-6-5-9-21(22)29-15-17-30(18-16-29)24-25(28-14-13-27-24)33-19-23(31)26-12-11-20-7-3-2-4-8-20/h2-10,13-14H,11-12,15-19H2,1H3,(H,26,31) |
| InChIKey | FZKWOZPXDGKPKQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |