C20H19N3O3S — CID 155804067
ethyl 4-[(3-anilino-2-cyano-3-methylsulfanylprop-2-enoyl)amino]benzoate (PubChem CID 155804067) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is ethyl 4-[(3-anilino-2-cyano-3-methylsulfanylprop-2-enoyl)amino]benzoate.
| Compound Name | ethyl 4-[(3-anilino-2-cyano-3-methylsulfanylprop-2-enoyl)amino]benzoate |
|---|---|
| PubChem CID | 155804067 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | ethyl 4-[(3-anilino-2-cyano-3-methylsulfanylprop-2-enoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C#N)=C(Nc2ccccc2)SC)cc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-3-26-20(25)14-9-11-16(12-10-14)22-18(24)17(13-21)19(27-2)23-15-7-5-4-6-8-15/h4-12,23H,3H2,1-2H3,(H,22,24) |
| InChIKey | VJGMDMOMGPKMQY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|