C19H19N3OS — CID 12004990
(E)-2-cyano-3-(2-methylanilino)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide (PubChem CID 12004990) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is (E)-2-cyano-3-(2-methylanilino)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2-methylanilino)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide |
|---|---|
| PubChem CID | 12004990 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (E)-2-cyano-3-(2-methylanilino)-3-[(2-methylphenyl)methylsulfanyl]prop-2-enamide |
| SMILES | Cc1ccccc1CS/C(Nc1ccccc1C)=C(\C#N)C(N)=O |
| InChI | InChI=1S/C19H19N3OS/c1-13-7-3-5-9-15(13)12-24-19(16(11-20)18(21)23)22-17-10-6-4-8-14(17)2/h3-10,22H,12H2,1-2H3,(H2,21,23)/b19-16+ |
| InChIKey | HYNWODXYFZKHDZ-KNTRCKAVSA-N |
| XLogP | 3.87 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|