About (2-methylphenyl)urea;phosphane
(2-methylphenyl)urea;phosphane (PubChem CID 175888509) has the molecular formula C8H13N2OP
and a molecular weight of 184.18 g/mol. Its IUPAC name is (2-methylphenyl)urea;phosphane.
Molecular Properties
| Compound Name | (2-methylphenyl)urea;phosphane |
| PubChem CID | 175888509 |
| Molecular Formula | C8H13N2OP |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (2-methylphenyl)urea;phosphane |
| SMILES | Cc1ccccc1NC(N)=O.P |
| InChI | InChI=1S/C8H10N2O.H3P/c1-6-4-2-3-5-7(6)10-8(9)11;/h2-5H,1H3,(H3,9,10,11);1H3 |
| InChIKey | UUKYBTFJUCTRQF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)urea;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)urea;phosphane?
The IUPAC name of (2-methylphenyl)urea;phosphane (CID 175888509) is (2-methylphenyl)urea;phosphane.
What is the SMILES notation for (2-methylphenyl)urea;phosphane?
The canonical SMILES for (2-methylphenyl)urea;phosphane is Cc1ccccc1NC(N)=O.P.
What is the InChIKey of (2-methylphenyl)urea;phosphane?
The InChIKey is UUKYBTFJUCTRQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.H3P/c1-6-4-2-3-5-7(6)10-8(9)11;/h2-5H,1H3,(H3,9,10,11);1H3.
What are the key properties of (2-methylphenyl)urea;phosphane?
(2-methylphenyl)urea;phosphane has a molecular weight of 184.18 g/mol, XLogP of 1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)urea;phosphane is sourced from PubChem (CID 175888509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).