C17H21N3O2 — CID 160854655
acetic acid;1,2-bis(2-methylphenyl)guanidine (PubChem CID 160854655) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is acetic acid;1,2-bis(2-methylphenyl)guanidine.
| Compound Name | acetic acid;1,2-bis(2-methylphenyl)guanidine |
|---|---|
| PubChem CID | 160854655 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | acetic acid;1,2-bis(2-methylphenyl)guanidine |
| SMILES | CC(=O)O.Cc1ccccc1/N=C(\N)Nc1ccccc1C |
| InChI | InChI=1S/C15H17N3.C2H4O2/c1-11-7-3-5-9-13(11)17-15(16)18-14-10-6-4-8-12(14)2;1-2(3)4/h3-10H,1-2H3,(H3,16,17,18);1H3,(H,3,4) |
| InChIKey | SJSALUXOKPNPNF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|