C21H22N6 — CID 57051109
1-[[N'-(2-methylphenyl)carbamimidoyl]amino]-2,3-diphenylguanidine (PubChem CID 57051109) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[[N'-(2-methylphenyl)carbamimidoyl]amino]-2,3-diphenylguanidine.
| Compound Name | 1-[[N'-(2-methylphenyl)carbamimidoyl]amino]-2,3-diphenylguanidine |
|---|---|
| PubChem CID | 57051109 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-[[N'-(2-methylphenyl)carbamimidoyl]amino]-2,3-diphenylguanidine |
| SMILES | Cc1ccccc1/N=C(\N)NN/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C21H22N6/c1-16-10-8-9-15-19(16)25-20(22)26-27-21(23-17-11-4-2-5-12-17)24-18-13-6-3-7-14-18/h2-15H,1H3,(H3,22,25,26)(H2,23,24,27) |
| InChIKey | CQXGYCPQHFFCSH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|