C21H20N2 — CID 3332745
N'-(2-methylphenyl)-N-(4-methylphenyl)benzenecarboximidamide (PubChem CID 3332745) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N'-(2-methylphenyl)-N-(4-methylphenyl)benzenecarboximidamide.
| Compound Name | N'-(2-methylphenyl)-N-(4-methylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 3332745 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N'-(2-methylphenyl)-N-(4-methylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccc(N/C(=N/c2ccccc2C)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2/c1-16-12-14-19(15-13-16)22-21(18-9-4-3-5-10-18)23-20-11-7-6-8-17(20)2/h3-15H,1-2H3,(H,22,23) |
| InChIKey | JRENNDVRGKQXMM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|