C21H19BrN2 — CID 102484487
N-(2-bromophenyl)-N'-(2,4-dimethylphenyl)benzenecarboximidamide (PubChem CID 102484487) has the molecular formula C21H19BrN2 and a molecular weight of 379.30 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-(2,4-dimethylphenyl)benzenecarboximidamide.
| Compound Name | N-(2-bromophenyl)-N'-(2,4-dimethylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 102484487 |
| Molecular Formula | C21H19BrN2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-(2-bromophenyl)-N'-(2,4-dimethylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccc(/N=C(\Nc2ccccc2Br)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H19BrN2/c1-15-12-13-19(16(2)14-15)23-21(17-8-4-3-5-9-17)24-20-11-7-6-10-18(20)22/h3-14H,1-2H3,(H,23,24) |
| InChIKey | ZVLSAJCFSFJJQE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|