C18H21ClN3+ — CID 20704493
[chloro-[(E)-[(2,4-dimethylanilino)-phenylmethylidene]amino]methylidene]-dimethylazanium (PubChem CID 20704493) has the molecular formula C18H21ClN3+ and a molecular weight of 314.84 g/mol. Its IUPAC name is [chloro-[(E)-[(2,4-dimethylanilino)-phenylmethylidene]amino]methylidene]-dimethylazanium.
| Compound Name | [chloro-[(E)-[(2,4-dimethylanilino)-phenylmethylidene]amino]methylidene]-dimethylazanium |
|---|---|
| PubChem CID | 20704493 |
| Molecular Formula | C18H21ClN3+ |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [chloro-[(E)-[(2,4-dimethylanilino)-phenylmethylidene]amino]methylidene]-dimethylazanium |
| SMILES | Cc1ccc(N/C(=N/C(Cl)=[N+](C)C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H20ClN3/c1-13-10-11-16(14(2)12-13)20-17(21-18(19)22(3)4)15-8-6-5-7-9-15/h5-12H,1-4H3/p+1 |
| InChIKey | NJHYHIJILGAUCZ-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|