C21H25N3O2 — CID 3462359
N-(2,4-dimethylphenyl)-N'-(1-phenylpropylideneamino)butanediamide (PubChem CID 3462359) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N'-(1-phenylpropylideneamino)butanediamide.
| Compound Name | N-(2,4-dimethylphenyl)-N'-(1-phenylpropylideneamino)butanediamide |
|---|---|
| PubChem CID | 3462359 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N'-(1-phenylpropylideneamino)butanediamide |
| SMILES | CCC(=NNC(=O)CCC(=O)Nc1ccc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-18(17-8-6-5-7-9-17)23-24-21(26)13-12-20(25)22-19-11-10-15(2)14-16(19)3/h5-11,14H,4,12-13H2,1-3H3,(H,22,25)(H,24,26) |
| InChIKey | ACEKQUGXYDDUKM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|