C21H19ClN2O2S — CID 6343610
N'-(benzenesulfonyl)-4-chloro-N-(2,4-dimethylphenyl)benzenecarboximidamide (PubChem CID 6343610) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-4-chloro-N-(2,4-dimethylphenyl)benzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-4-chloro-N-(2,4-dimethylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 6343610 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N'-(benzenesulfonyl)-4-chloro-N-(2,4-dimethylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccc(N/C(=N\S(=O)(=O)c2ccccc2)c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C21H19ClN2O2S/c1-15-8-13-20(16(2)14-15)23-21(17-9-11-18(22)12-10-17)24-27(25,26)19-6-4-3-5-7-19/h3-14H,1-2H3,(H,23,24) |
| InChIKey | MTINKXONPJYEMM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|