C20H17FN2O2S — CID 6195854
N'-(4-fluorophenyl)sulfonyl-N-(2-methylphenyl)benzenecarboximidamide (PubChem CID 6195854) has the molecular formula C20H17FN2O2S and a molecular weight of 368.43 g/mol. Its IUPAC name is N'-(4-fluorophenyl)sulfonyl-N-(2-methylphenyl)benzenecarboximidamide.
| Compound Name | N'-(4-fluorophenyl)sulfonyl-N-(2-methylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 6195854 |
| Molecular Formula | C20H17FN2O2S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N'-(4-fluorophenyl)sulfonyl-N-(2-methylphenyl)benzenecarboximidamide |
| SMILES | Cc1ccccc1N/C(=N\S(=O)(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H17FN2O2S/c1-15-7-5-6-10-19(15)22-20(16-8-3-2-4-9-16)23-26(24,25)18-13-11-17(21)12-14-18/h2-14H,1H3,(H,22,23) |
| InChIKey | NMAGOCRMFGDFKM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|