C20H16N2O4S — CID 66787006
2-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]amino]benzoic acid (PubChem CID 66787006) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]amino]benzoic acid.
| Compound Name | 2-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 66787006 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[[N-(benzenesulfonyl)-C-phenylcarbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O4S/c23-20(24)17-13-7-8-14-18(17)21-19(15-9-3-1-4-10-15)22-27(25,26)16-11-5-2-6-12-16/h1-14H,(H,21,22)(H,23,24) |
| InChIKey | RPOVDDOSDUSKCP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|