C22H18N2O5S — CID 6257393
N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(benzenesulfonyl)benzenecarboximidamide (PubChem CID 6257393) has the molecular formula C22H18N2O5S and a molecular weight of 422.46 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(benzenesulfonyl)benzenecarboximidamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(benzenesulfonyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 6257393 |
| Molecular Formula | C22H18N2O5S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(benzenesulfonyl)benzenecarboximidamide |
| SMILES | CC(=O)c1cc2c(cc1N/C(=N/S(=O)(=O)c1ccccc1)c1ccccc1)OCO2 |
| InChI | InChI=1S/C22H18N2O5S/c1-15(25)18-12-20-21(29-14-28-20)13-19(18)23-22(16-8-4-2-5-9-16)24-30(26,27)17-10-6-3-7-11-17/h2-13H,14H2,1H3,(H,23,24) |
| InChIKey | UAOIJWUBRWNCFP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|