C18H17NO4S — CID 7784900
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-benzylsulfanylacetamide (PubChem CID 7784900) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-2-benzylsulfanylacetamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-benzylsulfanylacetamide |
|---|---|
| PubChem CID | 7784900 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-benzylsulfanylacetamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)CSCc1ccccc1)OCO2 |
| InChI | InChI=1S/C18H17NO4S/c1-12(20)14-7-16-17(23-11-22-16)8-15(14)19-18(21)10-24-9-13-5-3-2-4-6-13/h2-8H,9-11H2,1H3,(H,19,21) |
| InChIKey | DHIVADSFBQNWTB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |