C24H21NO5 — CID 7924582
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2-benzylphenoxy)acetamide (PubChem CID 7924582) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2-benzylphenoxy)acetamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2-benzylphenoxy)acetamide |
|---|---|
| PubChem CID | 7924582 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(2-benzylphenoxy)acetamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)COc1ccccc1Cc1ccccc1)OCO2 |
| InChI | InChI=1S/C24H21NO5/c1-16(26)19-12-22-23(30-15-29-22)13-20(19)25-24(27)14-28-21-10-6-5-9-18(21)11-17-7-3-2-4-8-17/h2-10,12-13H,11,14-15H2,1H3,(H,25,27) |
| InChIKey | KOQUCRNBAWACBH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |