C24H19NO6 — CID 40695914
[2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-phenylbenzoate (PubChem CID 40695914) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-phenylbenzoate.
| Compound Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 40695914 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 4-phenylbenzoate |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)COC(=O)c1ccc(-c3ccccc3)cc1)OCO2 |
| InChI | InChI=1S/C24H19NO6/c1-15(26)19-11-21-22(31-14-30-21)12-20(19)25-23(27)13-29-24(28)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h2-12H,13-14H2,1H3,(H,25,27) |
| InChIKey | AFBXNQQPATVSBM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |