C22H24N2O6 — CID 7256866
[2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate (PubChem CID 7256866) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate.
| Compound Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate |
|---|---|
| PubChem CID | 7256866 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate |
| SMILES | CCCCNc1ccccc1C(=O)OCC(=O)Nc1cc2c(cc1C(C)=O)OCO2 |
| InChI | InChI=1S/C22H24N2O6/c1-3-4-9-23-17-8-6-5-7-15(17)22(27)28-12-21(26)24-18-11-20-19(29-13-30-20)10-16(18)14(2)25/h5-8,10-11,23H,3-4,9,12-13H2,1-2H3,(H,24,26) |
| InChIKey | OEPNEWJPDFDDFY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|