C20H20F2N2O5 — CID 7224284
[2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate (PubChem CID 7224284) has the molecular formula C20H20F2N2O5 and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate.
| Compound Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate |
|---|---|
| PubChem CID | 7224284 |
| Molecular Formula | C20H20F2N2O5 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 2-(butylamino)benzoate |
| SMILES | CCCCNc1ccccc1C(=O)OCC(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C20H20F2N2O5/c1-2-3-10-23-15-7-5-4-6-14(15)19(26)27-12-18(25)24-13-8-9-16-17(11-13)29-20(21,22)28-16/h4-9,11,23H,2-3,10,12H2,1H3,(H,24,25) |
| InChIKey | COPXGTMFPBXTPU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|