C19H16N2O8 — CID 7234172
[2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-methyl-2-nitrobenzoate (PubChem CID 7234172) has the molecular formula C19H16N2O8 and a molecular weight of 400.34 g/mol. Its IUPAC name is [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-methyl-2-nitrobenzoate.
| Compound Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-methyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 7234172 |
| Molecular Formula | C19H16N2O8 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [2-[(6-acetyl-1,3-benzodioxol-5-yl)amino]-2-oxoethyl] 3-methyl-2-nitrobenzoate |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)COC(=O)c1cccc(C)c1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H16N2O8/c1-10-4-3-5-12(18(10)21(25)26)19(24)27-8-17(23)20-14-7-16-15(28-9-29-16)6-13(14)11(2)22/h3-7H,8-9H2,1-2H3,(H,20,23) |
| InChIKey | CCQDNIODVRBTNY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|