C16H11Cl3N2O5 — CID 18289708
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-methyl-2-nitrobenzoate (PubChem CID 18289708) has the molecular formula C16H11Cl3N2O5 and a molecular weight of 417.63 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-methyl-2-nitrobenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-methyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 18289708 |
| Molecular Formula | C16H11Cl3N2O5 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 3-methyl-2-nitrobenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11Cl3N2O5/c1-8-3-2-4-10(15(8)21(24)25)16(23)26-7-13(22)20-14-11(18)5-9(17)6-12(14)19/h2-6H,7H2,1H3,(H,20,22) |
| InChIKey | NVDGACBBZYZTPK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|