C16H12Cl3NO3 — CID 7718015
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-methylbenzoate (PubChem CID 7718015) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-methylbenzoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 7718015 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3NO3/c1-9-4-2-3-5-11(9)16(22)23-8-14(21)20-15-12(18)6-10(17)7-13(15)19/h2-7H,8H2,1H3,(H,20,21) |
| InChIKey | QNYMZYJBHSIRKS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |