C17H15ClFNO3 — CID 71823566
[2-(2,6-dimethylanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate (PubChem CID 71823566) has the molecular formula C17H15ClFNO3 and a molecular weight of 335.76 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 71823566 |
| Molecular Formula | C17H15ClFNO3 |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 2-chloro-5-fluorobenzoate |
| SMILES | Cc1cccc(C)c1NC(=O)COC(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C17H15ClFNO3/c1-10-4-3-5-11(2)16(10)20-15(21)9-23-17(22)13-8-12(19)6-7-14(13)18/h3-8H,9H2,1-2H3,(H,20,21) |
| InChIKey | BMJRTLWUXDFMCX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |