C17H14ClF2NO3 — CID 7763930
[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2,4-difluorobenzoate (PubChem CID 7763930) has the molecular formula C17H14ClF2NO3 and a molecular weight of 353.75 g/mol. Its IUPAC name is [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2,4-difluorobenzoate.
| Compound Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 7763930 |
| Molecular Formula | C17H14ClF2NO3 |
| Molecular Weight | 353.75 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 2,4-difluorobenzoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)c2ccc(F)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClF2NO3/c1-9-5-10(2)16(13(18)6-9)21-15(22)8-24-17(23)12-4-3-11(19)7-14(12)20/h3-7H,8H2,1-2H3,(H,21,22) |
| InChIKey | DVZAHPXBAKWQGK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |