C21H17NO4 — CID 31483361
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-naphthalen-2-ylacetamide (PubChem CID 31483361) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 31483361 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-naphthalen-2-ylacetamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)Cc1ccc3ccccc3c1)OCO2 |
| InChI | InChI=1S/C21H17NO4/c1-13(23)17-10-19-20(26-12-25-19)11-18(17)22-21(24)9-14-6-7-15-4-2-3-5-16(15)8-14/h2-8,10-11H,9,12H2,1H3,(H,22,24) |
| InChIKey | VIKUGGAKMSQNPF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |