C17H14ClNO4 — CID 18076767
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)acetamide (PubChem CID 18076767) has the molecular formula C17H14ClNO4 and a molecular weight of 331.75 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 18076767 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-(4-chlorophenyl)acetamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=O)Cc1ccc(Cl)cc1)OCO2 |
| InChI | InChI=1S/C17H14ClNO4/c1-10(20)13-7-15-16(23-9-22-15)8-14(13)19-17(21)6-11-2-4-12(18)5-3-11/h2-5,7-8H,6,9H2,1H3,(H,19,21) |
| InChIKey | RGIYUEYLPVEFDW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |