C15H11Cl2NO3 — CID 41107875
2-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorophenyl)acetamide (PubChem CID 41107875) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 41107875 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(2,5-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H11Cl2NO3/c16-10-2-3-11(17)12(7-10)18-15(19)6-9-1-4-13-14(5-9)21-8-20-13/h1-5,7H,6,8H2,(H,18,19) |
| InChIKey | IFIWZZWOLXBBIL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |