C15H11Cl2NO4 — CID 5225250
1,3-benzodioxol-5-ylmethyl N-(2,4-dichlorophenyl)carbamate (PubChem CID 5225250) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl N-(2,4-dichlorophenyl)carbamate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl N-(2,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 5225250 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl N-(2,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11Cl2NO4/c16-10-2-3-12(11(17)6-10)18-15(19)20-7-9-1-4-13-14(5-9)22-8-21-13/h1-6H,7-8H2,(H,18,19) |
| InChIKey | AQQSLTBESBZRDU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |