C15H11Cl2NO3 — CID 673796
N-(1,3-benzodioxol-5-ylmethyl)-2,4-dichlorobenzamide (PubChem CID 673796) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,4-dichlorobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 673796 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4-dichlorobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2NO3/c16-10-2-3-11(12(17)6-10)15(19)18-7-9-1-4-13-14(5-9)21-8-20-13/h1-6H,7-8H2,(H,18,19) |
| InChIKey | PMVIDEWYBHLYMO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |